2-hydroxy-5-octoxybenzoic acid structure
|
Common Name | 2-hydroxy-5-octoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 79427-90-0 | Molecular Weight | 266.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-hydroxy-5-octoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H22O4 |
|---|---|
| Molecular Weight | 266.33300 |
| Exact Mass | 266.15200 |
| PSA | 66.76000 |
| LogP | 3.82970 |
| InChIKey | XIIKROUWHAKQKZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(O)c(C(=O)O)c1 |
| RIDADR | NONH for all modes of transport |
|---|
|
Alkylated dihydroxybenzoic acid as a MALDI matrix additive for hydrophobic peptide analysis.
Anal. Chem. 84(9) , 4237-43, (2012) Hydrophobic peptides are generally difficult to detect using matrix-assisted laser desorption/ionization mass spectrometry (MALDI-MS) because the majority of MALDI matrixes are hydrophilic and therefo... |
|
|
Alkylated trihydroxyacetophenone as a MALDI matrix for hydrophobic peptides.
Anal. Chem. 85(20) , 9444-8, (2013) Hydrophobic peptides are difficult to detect in matrix-assisted laser desorption/ionization mass spectrometry (MALDI-MS), because of the hydrophilic properties of conventional matrices and the low aff... |
| Benzoic acid,2-hydroxy-5-(octyloxy) |