5-(1-bromoethylidene)-3-phenyloxolan-2-one structure
|
Common Name | 5-(1-bromoethylidene)-3-phenyloxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 79054-06-1 | Molecular Weight | 267.11900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(1-bromoethylidene)-3-phenyloxolan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11BrO2 |
|---|---|
| Molecular Weight | 267.11900 |
| Exact Mass | 265.99400 |
| PSA | 26.30000 |
| LogP | 3.34350 |
| InChIKey | GHKIPZRZCAVFNK-UHFFFAOYSA-N |
| SMILES | CC(Br)=C1CC(c2ccccc2)C(=O)O1 |
|
~91%
5-(1-bromoethyl... CAS#:79054-06-1 |
| Literature: Krafft,G.A.; Katzenellenbogen,J.A. Journal of the American Chemical Society, 1981 , vol. 103, p. 5459 |
|
~%
5-(1-bromoethyl... CAS#:79054-06-1 |
| Literature: Krafft,G.A.; Katzenellenbogen,J.A. Journal of the American Chemical Society, 1981 , vol. 103, p. 5459 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2(3H)-Furanone,5-(1-bromoethylidene)dihydro-3-phenyl-,(E) |
| 3-phenyl-5(E)-(1-bromoethylidene)tetrahydro-2-furanone |