2-(4-chlorophenoxy)-5-nitrobenzonitrile
Modify Date: 2025-08-26 19:49:54
2-(4-chlorophenoxy)-5-nitrobenzonitrile structure
|
Common Name | 2-(4-chlorophenoxy)-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 78940-65-5 | Molecular Weight | 274.65900 | |
| Density | 1.45g/cm3 | Boiling Point | 384.8ºC at 760 mmHg | |
| Molecular Formula | C13H7ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.5ºC | |
| Name | 2-(4-chlorophenoxy)-5-nitrobenzonitrile |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 384.8ºC at 760 mmHg |
| Molecular Formula | C13H7ClN2O3 |
| Molecular Weight | 274.65900 |
| Flash Point | 186.5ºC |
| Exact Mass | 274.01500 |
| PSA | 78.84000 |
| LogP | 4.43538 |
| Index of Refraction | 1.645 |
| InChIKey | LIWRJJIPQLEUEK-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Oc1ccc(Cl)cc1 |
|
~%
2-(4-chlorophen... CAS#:78940-65-5 |
| Literature: The Dow Chemical Company Patent: US4332820 A1, 1982 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |