3,5-dimethyl-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[4,3-c]pyrimidine structure
|
Common Name | 3,5-dimethyl-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[4,3-c]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 78041-95-9 | Molecular Weight | 258.34200 | |
| Density | 1.56g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dimethyl-8,9,10,11-tetrahydro[1]benzothieno[3,2-e][1,2,4]triazolo[4,3-c]pyrimidine |
|---|
| Density | 1.56g/cm3 |
|---|---|
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.34200 |
| Exact Mass | 258.09400 |
| PSA | 71.32000 |
| LogP | 2.83460 |
| Index of Refraction | 1.831 |
| InChIKey | HZTFNWZISKIRNG-UHFFFAOYSA-N |
| SMILES | Cc1nnc2c3c4c(sc3nc(C)n12)CCCC4 |
|
~72%
3,5-dimethyl-8,... CAS#:78041-95-9 |
| Literature: Shishoo, C. J.; Devani, M. B.; Ullas, G. V.; Anathan, S.; Bhadti, V. S. Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 43 - 46 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |