2,6-bis[4-(azepan-1-yl)but-2-ynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone structure
|
Common Name | 2,6-bis[4-(azepan-1-yl)but-2-ynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone | ||
|---|---|---|---|---|
| CAS Number | 77762-98-2 | Molecular Weight | 514.61500 | |
| Density | 1.267g/cm3 | Boiling Point | 695.9ºC at 760mmHg | |
| Molecular Formula | C30H34N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.5ºC | |
| Name | 2,6-bis[4-(azepan-1-yl)but-2-ynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 695.9ºC at 760mmHg |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.61500 |
| Flash Point | 296.5ºC |
| Exact Mass | 514.25800 |
| PSA | 84.62000 |
| LogP | 1.54700 |
| InChIKey | INOQIRVUXKPPQH-UHFFFAOYSA-N |
| SMILES | O=c1c2cc3c(=O)n(CC#CCN4CCCCCC4)c(=O)c3cc2c(=O)n1CC#CCN1CCCCCC1 |
|
~28%
2,6-bis[4-(azep... CAS#:77762-98-2 |
| Literature: Eldeen; Cosmo; Ghantous; Khayat European Journal of Medicinal Chemistry, 1981 , vol. 16, # 1 p. 91 - 93 |
|
~%
2,6-bis[4-(azep... CAS#:77762-98-2 |
| Literature: Eldeen; Cosmo; Ghantous; Khayat European Journal of Medicinal Chemistry, 1981 , vol. 16, # 1 p. 91 - 93 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |