4-chloro-5-methyl-6-phenylpyrimidin-2-amine
Modify Date: 2024-01-20 16:54:48
4-chloro-5-methyl-6-phenylpyrimidin-2-amine structure
|
Common Name | 4-chloro-5-methyl-6-phenylpyrimidin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 77378-84-8 | Molecular Weight | 219.67000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-5-methyl-6-phenylpyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10ClN3 |
|---|---|
| Molecular Weight | 219.67000 |
| Exact Mass | 219.05600 |
| PSA | 52.53000 |
| LogP | 2.61770 |
| InChIKey | FYDXFOVDFWZZNU-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)nc(N)nc1-c1ccccc1 |
|
~%
4-chloro-5-meth... CAS#:77378-84-8 |
| Literature: Searle and Co. Patent: US2740785 , 1954 ; Full Text Show Details Burroughs Wellcome and Co. Patent: US2688019 , 1951 ; |
|
~%
4-chloro-5-meth... CAS#:77378-84-8 |
| Literature: Burroughs Wellcome and Co. Patent: US2688019 , 1951 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-chloro-5-methyl-6-phenyl-pyrimidin-2-ylamine |
| 2-Pyrimidinamine,4-chloro-5-methyl-6-phenyl |
| 4-Chlor-5-methyl-6-phenyl-pyrimidin-2-ylamin |