ethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate structure
|
Common Name | ethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 77207-01-3 | Molecular Weight | 389.71000 | |
| Density | 1.434g/cm3 | Boiling Point | 405.8ºC at 760 mmHg | |
| Molecular Formula | C16H11ClF3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.2ºC | |
| Name | ethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 405.8ºC at 760 mmHg |
| Molecular Formula | C16H11ClF3NO5 |
| Molecular Weight | 389.71000 |
| Flash Point | 199.2ºC |
| Exact Mass | 389.02800 |
| PSA | 81.35000 |
| LogP | 5.75920 |
| Index of Refraction | 1.542 |
| InChIKey | ZXYLZOBDCIFSPF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl acifluorfen |
| Acifluorfen-ethyl |