6-phenyl-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-4-one structure
|
Common Name | 6-phenyl-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 76697-02-4 | Molecular Weight | 214.26300 | |
| Density | 1.26g/cm3 | Boiling Point | 358.9ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.8ºC | |
| Name | 6-phenyl-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-4-one |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 358.9ºC at 760 mmHg |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26300 |
| Flash Point | 170.8ºC |
| Exact Mass | 214.11100 |
| PSA | 32.67000 |
| LogP | 1.52580 |
| Index of Refraction | 1.663 |
| InChIKey | VRIYBSNVBCDACJ-UHFFFAOYSA-N |
| SMILES | O=C1CCN=C2CCC(c3ccccc3)N12 |
|
~75%
6-phenyl-3,6,7,... CAS#:76697-02-4 |
| Literature: Langlois, Michel; Guilloneau, Claude; Van, Tri Vo; Jolly, Raymond; Maillard, Jacques Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 393 - 398 |
|
~%
6-phenyl-3,6,7,... CAS#:76697-02-4 |
| Literature: Langlois, Michel; Guilloneau, Claude; Van, Tri Vo; Jolly, Raymond; Maillard, Jacques Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 393 - 398 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |