4-(3,5-dimethylphenyl)but-1-ynoxy-tri(propan-2-yl)silane structure
|
Common Name | 4-(3,5-dimethylphenyl)but-1-ynoxy-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 765906-53-4 | Molecular Weight | 330.58000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H34OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,5-dimethylphenyl)but-1-ynoxy-tri(propan-2-yl)silane |
|---|
| Molecular Formula | C21H34OSi |
|---|---|
| Molecular Weight | 330.58000 |
| Exact Mass | 330.23800 |
| PSA | 9.23000 |
| LogP | 6.38900 |
| InChIKey | NKBXRUHOCXZLTC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(CCC#CO[Si](C(C)C)(C(C)C)C(C)C)c1 |
|
~93%
4-(3,5-dimethyl... CAS#:765906-53-4 |
| Literature: Zhang, Liming; Kozmin, Sergey A. Journal of the American Chemical Society, 2004 , vol. 126, # 33 p. 10204 - 10205 |
|
~%
4-(3,5-dimethyl... CAS#:765906-53-4 |
| Literature: Zhang, Liming; Kozmin, Sergey A. Journal of the American Chemical Society, 2004 , vol. 126, # 33 p. 10204 - 10205 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |