brn 5632392 structure
|
Common Name | brn 5632392 | ||
|---|---|---|---|---|
| CAS Number | 76099-17-7 | Molecular Weight | 346.30300 | |
| Density | 1.52g/cm3 | Boiling Point | 508.5ºC at 760 mmHg | |
| Molecular Formula | C18H13F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.3ºC | |
| Name | brn 5632392 |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 508.5ºC at 760 mmHg |
| Molecular Formula | C18H13F3N2O2 |
| Molecular Weight | 346.30300 |
| Flash Point | 261.3ºC |
| Exact Mass | 346.09300 |
| PSA | 36.28000 |
| LogP | 3.68520 |
| Index of Refraction | 1.651 |
| InChIKey | ZJYRKVCNSBHAFA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(c1)nc1n2CC2COC1(c1ccccc1)O2 |
|
~%
brn 5632392 CAS#:76099-17-7 |
| Literature: Dostert; Langlois; Guerret; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 199 - 205 |
|
~%
brn 5632392 CAS#:76099-17-7 |
| Literature: Dostert; Langlois; Guerret; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 199 - 205 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |