5-chloro-3-(2-pyridin-4-ylethyl)-1H-indole structure
|
Common Name | 5-chloro-3-(2-pyridin-4-ylethyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 75259-79-9 | Molecular Weight | 256.73000 | |
| Density | 1.28g/cm3 | Boiling Point | 433.8ºC at 760 mmHg | |
| Molecular Formula | C15H13ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.7ºC | |
| Name | 5-chloro-3-(2-pyridin-4-ylethyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760 mmHg |
| Molecular Formula | C15H13ClN2 |
| Molecular Weight | 256.73000 |
| Flash Point | 248.7ºC |
| Exact Mass | 256.07700 |
| PSA | 28.68000 |
| LogP | 4.00150 |
| Index of Refraction | 1.677 |
| InChIKey | WXJHBMDJCMGNBU-UHFFFAOYSA-N |
| SMILES | Clc1ccc2[nH]cc(CCc3ccncc3)c2c1 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-chloro-3-(2-(4-pyridyl)ethyl)indole |
| 5-CHLORO-3-[2-(4-PYRIDINYL)ETHYL]-INDOLE |