(1,3-dioxo-2-phenyl-2,3-dihydro-1H-inden-2-yl)acetic acid() structure
|
Common Name | (1,3-dioxo-2-phenyl-2,3-dihydro-1H-inden-2-yl)acetic acid() | ||
|---|---|---|---|---|
| CAS Number | 7443-02-9 | Molecular Weight | 280.27500 | |
| Density | 1.358g/cm3 | Boiling Point | 533.6ºC at 760 mmHg | |
| Molecular Formula | C17H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.6ºC | |
| Name | (1,3-dioxo-2-phenyl-2,3-dihydro-1H-inden-2-yl)acetic acid() |
|---|
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 533.6ºC at 760 mmHg |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.27500 |
| Flash Point | 290.6ºC |
| Exact Mass | 280.07400 |
| PSA | 71.44000 |
| LogP | 2.47830 |
| Index of Refraction | 1.635 |
| InChIKey | LUSCNFVZKACQIA-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1(c2ccccc2)C(=O)c2ccccc2C1=O |
| HS Code | 2918300090 |
|---|
|
~99%
(1,3-dioxo-2-ph... CAS#:7443-02-9 |
| Literature: Bristol-Myers Squibb Company Patent: US2007/185056 A1, 2007 ; Location in patent: Page/Page column 24 ; US 20070185056 A1 |
|
~%
(1,3-dioxo-2-ph... CAS#:7443-02-9 |
| Literature: Radulescu; Gheorghiu Chemische Berichte, 1927 , vol. 60, p. 190 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |