(4-chlorophenoxy)carbonylphosphonic acid
Modify Date: 2024-01-09 11:03:17
(4-chlorophenoxy)carbonylphosphonic acid structure
|
Common Name | (4-chlorophenoxy)carbonylphosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 74270-33-0 | Molecular Weight | 236.54600 | |
| Density | 1.669g/cm3 | Boiling Point | 428.3ºC at 760 mmHg | |
| Molecular Formula | C7H6ClO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | (4-chlorophenoxy)carbonylphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.669g/cm3 |
|---|---|
| Boiling Point | 428.3ºC at 760 mmHg |
| Molecular Formula | C7H6ClO5P |
| Molecular Weight | 236.54600 |
| Flash Point | 212.8ºC |
| Exact Mass | 235.96400 |
| PSA | 93.64000 |
| LogP | 2.01650 |
| Index of Refraction | 1.589 |
| InChIKey | XPVUKGSFIHHHIT-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(Cl)cc1)P(=O)(O)O |
|
~86%
(4-chlorophenox... CAS#:74270-33-0 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~%
(4-chlorophenox... CAS#:74270-33-0 |
| Literature: Astra Lakemedel Aktiebolag Patent: US4372894 A1, 1983 ; US 4372894 A |
|
~%
(4-chlorophenox... CAS#:74270-33-0 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Disodium p-chlorophenoxycarbonylphosphonate |
| Phosphinecarboxylic acid,dihydroxy-,4-chlorophenyl ester,oxide |