[2-[[2-(4-benzylpiperazine-1-carbonyl)phenyl]disulfanyl]phenyl]-(4-benzylpiperazin-1-yl)methanone,dihydrochloride structure
|
Common Name | [2-[[2-(4-benzylpiperazine-1-carbonyl)phenyl]disulfanyl]phenyl]-(4-benzylpiperazin-1-yl)methanone,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 73845-35-9 | Molecular Weight | 695.76400 | |
| Density | N/A | Boiling Point | 753.9ºC at 760 mmHg | |
| Molecular Formula | C36H40Cl2N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 409.7ºC | |
| Name | [2-[[2-(4-benzylpiperazine-1-carbonyl)phenyl]disulfanyl]phenyl]-(4-benzylpiperazin-1-yl)methanone,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 753.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C36H40Cl2N4O2S2 |
| Molecular Weight | 695.76400 |
| Flash Point | 409.7ºC |
| Exact Mass | 694.19700 |
| PSA | 97.70000 |
| LogP | 7.75760 |
| InChIKey | SFLGKNKYNPOVLF-UHFFFAOYSA-N |
| SMILES | Cl.Cl.O=C(c1ccccc1SSc1ccccc1C(=O)N1CCN(Cc2ccccc2)CC1)N1CCN(Cc2ccccc2)CC1 |
|
~78%
[2-[[2-(4-benzy... CAS#:73845-35-9 |
| Literature: Yamada; Niino; Hashimoto; Shuto; Nakamizo; Kubo; Ono; Murayama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1214 - 1220 |
|
~%
[2-[[2-(4-benzy... CAS#:73845-35-9 |
| Literature: Yamada; Niino; Hashimoto; Shuto; Nakamizo; Kubo; Ono; Murayama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1214 - 1220 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Piperazine,1,1'-(dithiobis(2,1-phenylenecarbonyl))bis(4-(phenylmethyl)-,dihydrochloride |
| 1,1'-(Dithiobis(2,1-phenylenecarbonyl))bis(4-(phenylmethyl)piperazine hydrochloride) |
| 4-Benzylpiperazinyl 2-[(2-{[4-benzylpiperazinyl]carbonyl}phenyl)disulfanyl]phenyl ketone dihydrochloride |
| 2,2'-dithiobis(N'-benzylbenzpiperazide) hydrochloride |