1,3-dichloro-2-(6-diethoxyphosphorylhexoxy)benzene structure
|
Common Name | 1,3-dichloro-2-(6-diethoxyphosphorylhexoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 73514-92-8 | Molecular Weight | 383.24700 | |
| Density | 1.187g/cm3 | Boiling Point | 470.7ºC at 760 mmHg | |
| Molecular Formula | C16H25Cl2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 394.9ºC | |
| Name | 1,3-dichloro-2-(6-diethoxyphosphorylhexoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 470.7ºC at 760 mmHg |
| Molecular Formula | C16H25Cl2O4P |
| Molecular Weight | 383.24700 |
| Flash Point | 394.9ºC |
| Exact Mass | 382.08700 |
| PSA | 54.57000 |
| LogP | 6.19870 |
| Index of Refraction | 1.499 |
| InChIKey | GBTQUMXCSHNNEV-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCCCCOc1c(Cl)cccc1Cl)OCC |
|
~%
1,3-dichloro-2-... CAS#:73514-92-8 |
| Literature: Sterling Drug Inc. Patent: US4182759 A1, 1980 ; |
|
~32%
1,3-dichloro-2-... CAS#:73514-92-8 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,(6-(2,6-dichlorophenoxy)hexyl)-,diethyl ester |
| Diethyl [6-(2,6-dichlorophenoxy)hexyl]phosphonate |