4-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)butanoic acid structure
|
Common Name | 4-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 73211-20-8 | Molecular Weight | 318.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18N2O5 |
|---|---|
| Molecular Weight | 318.32500 |
| Exact Mass | 318.12200 |
| PSA | 103.78000 |
| LogP | 1.54430 |
| InChIKey | CAKKYRPAEHEPKD-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)N(CCCC(=O)O)C1=O |
|
~%
4-(5-ethyl-2,4,... CAS#:73211-20-8 |
| Literature: Sayo; Hosokawa Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 9 p. 3706 - 3709 |
|
~%
4-(5-ethyl-2,4,... CAS#:73211-20-8 |
| Literature: Sayo; Hosokawa Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 9 p. 3706 - 3709 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-ETHYLTETRAHYDRO-2,4,6-TRIOXO-5-PHENYL-1(2H)PYRIMIDINEBUTANOIC ACID |
| Phenobarbital 1-Butyric Acid |
| 5-ethyl-5-phenylbarbituryl-1-butyric acid |