1,3-dimethyl-1-(4-nitrophenyl)-3-nitrosourea structure
|
Common Name | 1,3-dimethyl-1-(4-nitrophenyl)-3-nitrosourea | ||
|---|---|---|---|---|
| CAS Number | 72586-69-7 | Molecular Weight | 238.20000 | |
| Density | 1.37g/cm3 | Boiling Point | 370.1ºC at 760 mmHg | |
| Molecular Formula | C9H10N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.6ºC | |
| Name | 1,3-dimethyl-1-(4-nitrophenyl)-3-nitrosourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 370.1ºC at 760 mmHg |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20000 |
| Flash Point | 177.6ºC |
| Exact Mass | 238.07000 |
| PSA | 98.80000 |
| LogP | 2.28740 |
| Index of Refraction | 1.6 |
| InChIKey | TYOCLJQLJIKHDG-UHFFFAOYSA-N |
| SMILES | CN(N=O)C(=O)N(C)c1ccc([N+](=O)[O-])cc1 |
|
~54%
1,3-dimethyl-1-... CAS#:72586-69-7 |
| Literature: Yoshida, Kitaro; Yano, Kazuyuki Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 7 p. 2200 - 2203 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 1,3-dimethyl-3-(4-nitrophenyl)-1-nitroso-urea |
| N,N'-dimethyl-N'-(p-nitrophenyl)-N-nitrosourea |
| Urea,1,3-dimethyl-1-(p-nitrophenyl)-3-nitroso |
| N-Methyl-N'-(p-nitrophenyl)-N'-methyl-N-nitrosourea |