but-1-ene,N,N-diethylhydroxylamine,2,2,4,4-tetramethyl-1,3,5,7,2,4,6λ2,8λ2-tetraoxatetrasilocane structure
|
Common Name | but-1-ene,N,N-diethylhydroxylamine,2,2,4,4-tetramethyl-1,3,5,7,2,4,6λ2,8λ2-tetraoxatetrasilocane | ||
|---|---|---|---|---|
| CAS Number | 72318-77-5 | Molecular Weight | 383.73600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H33NO5Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | but-1-ene,N,N-diethylhydroxylamine,2,2,4,4-tetramethyl-1,3,5,7,2,4,6λ2,8λ2-tetraoxatetrasilocane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H33NO5Si4 |
|---|---|
| Molecular Weight | 383.73600 |
| Exact Mass | 383.14400 |
| PSA | 41.93000 |
| LogP | 2.20200 |
| InChIKey | RHHYKTPRRBYICA-UHFFFAOYSA-N |
| SMILES | C=CCC.CCN(O)CC.C[Si]1(C)O[Si]O[Si]O[Si](C)(C)O1 |
| EINECS 276-579-0 |
| Ethanamine,N-ethyl-N-hydroxy-,reaction products with 1-butene and tetramethylcyclotetrasiloxane |
| 2,2,4,4-tetramethyl-1,3,5,7,2,4,6 |