2-benzyl-6-nitro-1H-benzimidazole structure
|
Common Name | 2-benzyl-6-nitro-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 7189-72-2 | Molecular Weight | 253.25600 | |
| Density | 1.359g/cm3 | Boiling Point | 537.7ºC at 760 mmHg | |
| Molecular Formula | C14H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279ºC | |
| Name | 2-benzyl-6-nitro-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 537.7ºC at 760 mmHg |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.25600 |
| Flash Point | 279ºC |
| Exact Mass | 253.08500 |
| PSA | 74.50000 |
| LogP | 3.58510 |
| Index of Refraction | 1.705 |
| InChIKey | UMWIVOZCYNITGG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2nc(Cc3ccccc3)[nH]c2c1 |
|
~89%
2-benzyl-6-nitr... CAS#:7189-72-2 |
| Literature: Kahveci, Bahittin; Sosan, Nesibe; Mentese, Emre; Yilmaz, Fatih Revue Roumaine de Chimie, 2013 , vol. 58, # 6 p. 511 - 515 |
|
~72%
2-benzyl-6-nitr... CAS#:7189-72-2 |
| Literature: Ram; Wise; Townsend Journal of Heterocyclic Chemistry, 1986 , vol. 23, # 4 p. 1109 - 1113 |
|
~%
2-benzyl-6-nitr... CAS#:7189-72-2 |
| Literature: Feitelson; Rothstein Journal of the Chemical Society, 1958 , p. 2426 |
|
~%
2-benzyl-6-nitr... CAS#:7189-72-2 |
| Literature: Feitelson; Rothstein Journal of the Chemical Society, 1958 , p. 2426 |
|
~%
2-benzyl-6-nitr... CAS#:7189-72-2 |
| Literature: Feitelson; Rothstein Journal of the Chemical Society, 1958 , p. 2426 |
| Benzyl-2 nitro-5 benzimidazole [French] |
| 2-benzyl-5-nitro-1H-benzo[d]imidazole |
| 2-benzyl-5-nitro-1H-benzimidazole |
| 1-benzyl-5-nitro-1(3)H-benzoimidazole |
| BENZIMIDAZOLE,2-BENZYL-5-NITRO |
| 2-benzyl-5(6)-nitro-1H-benzimidazole |
| Benzyl-2 nitro-5 benzimidazole |
| 2-Benzyl-5-nitrobenzimidazole |
| 2-benzyl-5(6)-nitrobenzimidazole |
| 2-Benzyl-5-nitro-1(3)H-benzimidazol |