methyl 2-methoxy-6-phenyl-1a,2,3a,4,7a,7b-hexahydro-[1,3]dioxino[4,5]pyrano[1,2-b]azirine-1-carbodithioate
Modify Date: 2025-09-07 19:17:44
![methyl 2-methoxy-6-phenyl-1a,2,3a,4,7a,7b-hexahydro-[1,3]dioxino[4,5]pyrano[1,2-b]azirine-1-carbodithioate Structure](https://image.chemsrc.com/caspic/466/7147-13-9.png)
methyl 2-methoxy-6-phenyl-1a,2,3a,4,7a,7b-hexahydro-[1,3]dioxino[4,5]pyrano[1,2-b]azirine-1-carbodithioate structure
|
Common Name | methyl 2-methoxy-6-phenyl-1a,2,3a,4,7a,7b-hexahydro-[1,3]dioxino[4,5]pyrano[1,2-b]azirine-1-carbodithioate | ||
|---|---|---|---|---|
| CAS Number | 7147-13-9 | Molecular Weight | 353.45600 | |
| Density | 1.4g/cm3 | Boiling Point | 491.3ºC at 760 mmHg | |
| Molecular Formula | C16H19NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.9ºC | |
| Name | methyl 2-methoxy-6-phenyl-1a,2,3a,4,7a,7b-hexahydro-[1,3]dioxino[4,5]pyrano[1,2-b]azirine-1-carbodithioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 491.3ºC at 760 mmHg |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.45600 |
| Flash Point | 250.9ºC |
| Exact Mass | 353.07600 |
| PSA | 97.32000 |
| LogP | 2.11050 |
| Index of Refraction | 1.659 |
| InChIKey | SMMQRRVKRYCIDI-UHFFFAOYSA-N |
| SMILES | COC1OC2COC(c3ccccc3)OC2C2C1N2C(=S)SC |
|
~%
methyl 2-methox... CAS#:7147-13-9 |
| Literature: Christensen,J.E.; Goodman,L. Journal of the American Chemical Society, 1960 , vol. 82, p. 4738 - 4739 |
![Altropyranoside, methyl4,6-O-benzylidene-3-deoxy-3-[(dithiocarboxy)amino]-, methyl ester,methanesulfonate (ester), a-D- (6CI,7CI,8CI) structure](https://image.chemsrc.com/caspic/114/6945-62-6.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| methyl 6-methoxy-2-phenylhexahydro-7h-[1,3]dioxino[4',5':5,6]pyrano[3,4-b]azirene-7-carbodithioate |