ethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium,ethyl sulfate,prop-2-enamide
Modify Date: 2025-11-12 18:44:53
![ethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium,ethyl sulfate,prop-2-enamide Structure](https://image.chemsrc.com/caspic/072/70942-20-0.png)
ethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium,ethyl sulfate,prop-2-enamide structure
|
Common Name | ethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium,ethyl sulfate,prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 70942-20-0 | Molecular Weight | 395.51500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H33N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium,ethyl sulfate,prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H33N3O6S |
|---|---|
| Molecular Weight | 395.51500 |
| Exact Mass | 395.20900 |
| PSA | 151.48000 |
| LogP | 3.59180 |
| InChIKey | YXHLZVMQWSERIU-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CC.C=CC(N)=O.CCOS(=O)(=O)[O-] |
| 1-Propanaminium,N-ethyl-N,N-dimethyl-3-((2-methyl-1-oxo-2-propen-1-yl)amino)-,ethyl sulfate (1:1),polymer with 2-propenamide |
| 1-Propanaminium,N-ethyl-N,N-dimethyl-3-((2-methyl-1-oxo-2-propenyl)amino)-,ethyl sulfate,polymer with 2-propenamide |