3-(4-methoxyphenyl)-5,6-dimethylinden-1-one structure
|
Common Name | 3-(4-methoxyphenyl)-5,6-dimethylinden-1-one | ||
|---|---|---|---|---|
| CAS Number | 705255-92-1 | Molecular Weight | 264.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methoxyphenyl)-5,6-dimethylinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H16O2 |
|---|---|
| Molecular Weight | 264.31800 |
| Exact Mass | 264.11500 |
| PSA | 26.30000 |
| LogP | 3.94000 |
| InChIKey | PHIGWPFCWWHKJD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=CC(=O)c3cc(C)c(C)cc32)cc1 |
|
~%
3-(4-methoxyphe... CAS#:705255-92-1 |
| Literature: Vasilyev; Walspurger; Haouas; Sommer; Pale; Rudenko Organic and Biomolecular Chemistry, 2004 , vol. 2, # 23 p. 3483 - 3489 |
|
~%
3-(4-methoxyphe... CAS#:705255-92-1 |
| Literature: Vasilyev; Walspurger; Haouas; Sommer; Pale; Rudenko Organic and Biomolecular Chemistry, 2004 , vol. 2, # 23 p. 3483 - 3489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Inden-1-one,3-(4-methoxyphenyl)-5,6-dimethyl |
| 3-(4-methoxyphenyl)-5,6-dimethylindenone |
| 5,6-dimethyl-3-(4-methoxyphenyl)inden-1-one |