4-(3-ethyl-2-phenylimino-1,3-thiazol-4-yl)-N,N-dimethylbenzenesulfonamide structure
|
Common Name | 4-(3-ethyl-2-phenylimino-1,3-thiazol-4-yl)-N,N-dimethylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7026-93-9 | Molecular Weight | 387.51900 | |
| Density | 1.24g/cm3 | Boiling Point | 543.7ºC at 760mmHg | |
| Molecular Formula | C19H21N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.6ºC | |
| Name | 4-(3-ethyl-2-phenylimino-1,3-thiazol-4-yl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 543.7ºC at 760mmHg |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.51900 |
| Flash Point | 282.6ºC |
| Exact Mass | 387.10800 |
| PSA | 91.29000 |
| LogP | 4.80000 |
| Index of Refraction | 1.627 |
| InChIKey | CTTPSLJMZPKQAQ-UHFFFAOYSA-N |
| SMILES | CCn1c(-c2ccc(S(=O)(=O)N(C)C)cc2)csc1=Nc1ccccc1 |
|
~%
4-(3-ethyl-2-ph... CAS#:7026-93-9 |
| Literature: Dowbenko,R. Journal of Organic Chemistry, 1962 , vol. 27, p. 787 - 791 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-[(2Z)-3-ethyl-2-(phenylimino)-2,3-dihydro-1,3-thiazol-4-yl]-N,N-dimethylbenzenesulfonamide |
| 3-Methoxy-5-butyloxymethyl-cyclopenten-(1) |