4-methylpent-3-enyl(triphenyl)phosphanium,iodide structure
|
Common Name | 4-methylpent-3-enyl(triphenyl)phosphanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 70240-40-3 | Molecular Weight | 472.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26IP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methylpent-3-enyl(triphenyl)phosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H26IP |
|---|---|
| Molecular Weight | 472.34100 |
| Exact Mass | 472.08200 |
| PSA | 13.59000 |
| LogP | 2.34080 |
| InChIKey | NSKICJCBEKKAMI-UHFFFAOYSA-M |
| SMILES | CC(C)=CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
|
~%
4-methylpent-3-... CAS#:70240-40-3 |
| Literature: Ansell,M.F.; Thomas,D.A. Journal of the Chemical Society, 1961 , p. 539 - 542 |
| Phosphonium,(4-methyl-3-pentenyl)triphenyl-,iodide |
| <4-Methyl-penten-(3)-yl>-triphenyl-phosphoniumhydroxid |
| triphenyl(4-methyl-3-pentenyl)phosphonium iodide |
| (4-methyl-pent-3-enyl)-triphenyl-phosphonium,iodide |