5-amino-6h-anthra[9,1-cd][1,2]thiazol-6-one structure
|
Common Name | 5-amino-6h-anthra[9,1-cd][1,2]thiazol-6-one | ||
|---|---|---|---|---|
| CAS Number | 6937-00-4 | Molecular Weight | 252.29100 | |
| Density | 1.539g/cm3 | Boiling Point | 429.6ºC at 760 mmHg | |
| Molecular Formula | C14H8N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.6ºC | |
| Name | 5-amino-6h-anthra[9,1-cd][1,2]thiazol-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 429.6ºC at 760 mmHg |
| Molecular Formula | C14H8N2OS |
| Molecular Weight | 252.29100 |
| Flash Point | 213.6ºC |
| Exact Mass | 252.03600 |
| PSA | 84.22000 |
| LogP | 3.67110 |
| Index of Refraction | 1.837 |
| InChIKey | VCLZHGSHIJOXRB-UHFFFAOYSA-N |
| SMILES | Nc1ccc2snc3c2c1C(=O)c1ccccc1-3 |
|
~%
5-amino-6h-anth... CAS#:6937-00-4 |
| Literature: Bayer and Co. Patent: DE216306 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 9, p. 744 |
|
~%
5-amino-6h-anth... CAS#:6937-00-4 |
| Literature: Bayer and Co. Patent: DE216306 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 9, p. 744 |
|
~%
5-amino-6h-anth... CAS#:6937-00-4 |
| Literature: Gattermann Justus Liebigs Annalen der Chemie, 1912 , vol. 393, p. 194 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-Amino-Anthraisothiazolon |