2,3-Dimethyl-5-nitrobenzenesulfonyl chloride
Modify Date: 2025-09-06 10:25:05
2,3-Dimethyl-5-nitrobenzenesulfonyl chloride structure
|
Common Name | 2,3-Dimethyl-5-nitrobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 68631-04-9 | Molecular Weight | 249.67100 | |
| Density | 1.464g/cm3 | Boiling Point | 400.5ºC at 760 mmHg | |
| Molecular Formula | C8H8ClNO4S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 196ºC | |
| Name | 2,3-Dimethyl-5-nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 400.5ºC at 760 mmHg |
| Molecular Formula | C8H8ClNO4S |
| Molecular Weight | 249.67100 |
| Flash Point | 196ºC |
| Exact Mass | 248.98600 |
| PSA | 88.34000 |
| LogP | 3.74310 |
| Index of Refraction | 1.566 |
| InChIKey | VPPPQFAKKFQYGQ-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)Cl)c1C |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,3-Dimethyl-5-nitrophenylsulfonyl chloride |
| EINECS 271-932-5 |
| 2,3-Dimethyl-5-nitrobenzene-1-sulphonyl chloride |