N'-(2-aminoethyl)ethane-1,2-diamine,2-[(4-methylphenoxy)methyl]oxirane structure
|
Common Name | N'-(2-aminoethyl)ethane-1,2-diamine,2-[(4-methylphenoxy)methyl]oxirane | ||
|---|---|---|---|---|
| CAS Number | 68411-70-1 | Molecular Weight | 267.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(2-aminoethyl)ethane-1,2-diamine,2-[(4-methylphenoxy)methyl]oxirane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H25N3O2 |
|---|---|
| Molecular Weight | 267.36700 |
| Exact Mass | 267.19500 |
| PSA | 85.83000 |
| LogP | 2.05750 |
| InChIKey | LQICHYJSSHLFIA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCC2CO2)cc1.NCCNCCN |
| Cresyl glycidyl ether diethylene triamine adduct |
| 1,2-Ethanediamine,N-(2-aminoethyl)-,reaction products with glycidyl p-tolyl ether |
| 1,2-Ethanediamine,N1-(2-aminoethyl)-,reaction products with glycidyl p-tolyl ether |