[1-(4-chlorophenyl)cycloprop-2-en-1-yl]methyl acetate
Modify Date: 2025-08-25 11:37:00
![[1-(4-chlorophenyl)cycloprop-2-en-1-yl]methyl acetate Structure](https://image.chemsrc.com/caspic/275/682760-59-4.png)
[1-(4-chlorophenyl)cycloprop-2-en-1-yl]methyl acetate structure
|
Common Name | [1-(4-chlorophenyl)cycloprop-2-en-1-yl]methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 682760-59-4 | Molecular Weight | 222.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(4-chlorophenyl)cycloprop-2-en-1-yl]methyl acetate |
|---|
| Molecular Formula | C12H11ClO2 |
|---|---|
| Molecular Weight | 222.66800 |
| Exact Mass | 222.04500 |
| PSA | 26.30000 |
| LogP | 2.71070 |
| InChIKey | FZIAOEBQJDKSID-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1(c2ccc(Cl)cc2)C=C1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |