2-ethylhexyl prop-2-enoate,2-methylpropyl 2-methylprop-2-enoate,styrene
Modify Date: 2025-09-02 13:10:33
2-ethylhexyl prop-2-enoate,2-methylpropyl 2-methylprop-2-enoate,styrene structure
|
Common Name | 2-ethylhexyl prop-2-enoate,2-methylpropyl 2-methylprop-2-enoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 68240-06-2 | Molecular Weight | 430.62000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H42O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethylhexyl prop-2-enoate,2-methylpropyl 2-methylprop-2-enoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H42O4 |
|---|---|
| Molecular Weight | 430.62000 |
| Exact Mass | 430.30800 |
| PSA | 52.60000 |
| LogP | 7.02330 |
| InChIKey | PBDORTHEWGDMCJ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(C)C.C=CC(=O)OCC(CC)CCCC.C=Cc1ccccc1 |
| 2-Propenoic acid,2-methyl-,2-methylpropyl ester,polymer with ethenylbenzene and 2-ethylhexyl 2-propenoate |
| Styrene,2-ethylhexyl acrylate,isobutyl methacrylate polymer |
| Ethenylbenzene,2-ethylhexyl propenoate,2-methylpropyl 2-methyl-2-propenoate polymer |