3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenylquinazolin-4-one structure
|
Common Name | 3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenylquinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 68142-70-1 | Molecular Weight | 320.36800 | |
| Density | 1.4g/cm3 | Boiling Point | 557ºC at 760mmHg | |
| Molecular Formula | C17H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.7ºC | |
| Name | 3-(5-methyl-1,3,4-thiadiazol-2-yl)-2-phenylquinazolin-4-one |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 557ºC at 760mmHg |
| Molecular Formula | C17H12N4OS |
| Molecular Weight | 320.36800 |
| Flash Point | 290.7ºC |
| Exact Mass | 320.07300 |
| PSA | 88.91000 |
| LogP | 3.21260 |
| InChIKey | PGLZQSKRVACWSR-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-n2c(-c3ccccc3)nc3ccccc3c2=O)s1 |
|
~81%
3-(5-methyl-1,3... CAS#:68142-70-1 |
| Literature: Kidwai, Mazaahir; Ruby; Rastogi, Shweta Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 2 p. 423 - 425 |
|
~90%
3-(5-methyl-1,3... CAS#:68142-70-1 |
| Literature: Kidwai, Mazaahir; Ruby; Rastogi, Shweta Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 2 p. 423 - 425 |