3-Bromo-N-(4-chloro-2-nitrophenyl)butanamide structure
|
Common Name | 3-Bromo-N-(4-chloro-2-nitrophenyl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 680579-53-7 | Molecular Weight | 321.55500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Bromo-N-(4-chloro-2-nitrophenyl)butanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10BrClN2O3 |
|---|---|
| Molecular Weight | 321.55500 |
| Exact Mass | 319.95600 |
| PSA | 78.41000 |
| LogP | 4.53290 |
| InChIKey | DBZMOLFRJVMPNZ-UHFFFAOYSA-N |
| SMILES | CC(Br)CC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
|
~%
3-Bromo-N-(4-ch... CAS#:680579-53-7 |
| Literature: Hall; Turner Journal of the Chemical Society, 1948 , p. 1909 |
| N1-(4-chloro-2-nitrophenyl)-3-bromobutanamide |
| 3-Brom-buttersaeure-(4-chlor-2-nitro-anilid) |
| 3-bromo-butyric acid-(4-chloro-2-nitro-anilide) |