[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] pentanoate structure
|
Common Name | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] pentanoate | ||
|---|---|---|---|---|
| CAS Number | 6678-00-8 | Molecular Weight | 446.57600 | |
| Density | 1.21g/cm3 | Boiling Point | 604.1ºC at 760mmHg | |
| Molecular Formula | C26H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 604.1ºC at 760mmHg |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.57600 |
| Flash Point | 198.5ºC |
| Exact Mass | 446.26700 |
| PSA | 100.90000 |
| LogP | 3.52270 |
| Index of Refraction | 1.56 |
| InChIKey | XHDMDWMKAYYIRK-FZNHGJLXSA-N |
| SMILES | CCCCC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C |
|
~%
[2-[(8S,9S,10R,... CAS#:6678-00-8 |
| Literature: Solo; Tramposch; Szeto; Suto Journal of Medicinal Chemistry, 1982 , vol. 25, # 6 p. 747 - 749 |
| hydrocortisone valerate |
| hydrocortisone 21-valerate |
| 11beta,17,21-Trihydroxypregn-4-ene-3,20-dione 21-valerate |
| EINECS 229-716-3 |
| cortisol 21-valerate |