4-[1-(cyclohexen-1-yl)-4-nitro-3-phenylbut-1-enyl]morpholine structure
|
Common Name | 4-[1-(cyclohexen-1-yl)-4-nitro-3-phenylbut-1-enyl]morpholine | ||
|---|---|---|---|---|
| CAS Number | 66312-70-7 | Molecular Weight | 342.43200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[1-(cyclohexen-1-yl)-4-nitro-3-phenylbut-1-enyl]morpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H26N2O3 |
|---|---|
| Molecular Weight | 342.43200 |
| Exact Mass | 342.19400 |
| PSA | 58.29000 |
| LogP | 4.22450 |
| InChIKey | QOORKPGMNDRRIR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CC(C=C(C1=CCCCC1)N1CCOCC1)c1ccccc1 |
|
~%
4-[1-(cyclohexe... CAS#:66312-70-7
Detail
|
| Literature: Barluenga, Jose; Aznar, Fernando; Cabal, Maria-Paz; Valdes, Carlos Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , p. 633 - 638 |
|
~%
4-[1-(cyclohexe... CAS#:66312-70-7 |
| Literature: Pitacco,G. et al. Tetrahedron, 1977 , vol. 33, p. 3145 - 3148 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Morpholine,4-[1-(1-cyclohexen-1-yl)-4-nitro-3-phenyl-1-butenyl] |
| 4-(1-cyclohex-1-enyl-4-nitro-3-phenyl-but-1-enyl)-morpholine |