ethyl 2-acetyloxyoct-2-enoate structure
|
Common Name | ethyl 2-acetyloxyoct-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 66150-20-7 | Molecular Weight | 228.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-acetyloxyoct-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20O4 |
|---|---|
| Molecular Weight | 228.28500 |
| Exact Mass | 228.13600 |
| PSA | 52.60000 |
| LogP | 2.57680 |
| InChIKey | CSECKHYMSBEYQY-UHFFFAOYSA-N |
| SMILES | CCCCCC=C(OC(C)=O)C(=O)OCC |
|
~%
ethyl 2-acetylo... CAS#:66150-20-7 |
| Literature: Burk, Mark J.; Kalberg, Christopher S.; Pizzano, Antonio Journal of the American Chemical Society, 1998 , vol. 120, # 18 p. 4345 - 4353 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Octenoic acid,2-(acetyloxy)-,ethyl ester |