3',4'-Dihydroxy Flurbiprofen
Modify Date: 2025-08-28 18:20:55
3',4'-Dihydroxy Flurbiprofen structure
|
Common Name | 3',4'-Dihydroxy Flurbiprofen | ||
|---|---|---|---|---|
| CAS Number | 66067-41-2 | Molecular Weight | 276.26000 | |
| Density | 1.377g/cm3 | Boiling Point | 469ºC at 760 mmHg | |
| Molecular Formula | C15H13FO4 | Melting Point | 140-142ºC | |
| MSDS | N/A | Flash Point | 237.5ºC | |
| Name | 3',4'-Dihydroxy Flurbiprofen |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 469ºC at 760 mmHg |
| Melting Point | 140-142ºC |
| Molecular Formula | C15H13FO4 |
| Molecular Weight | 276.26000 |
| Flash Point | 237.5ºC |
| Exact Mass | 276.08000 |
| PSA | 77.76000 |
| LogP | 3.09200 |
| Index of Refraction | 1.619 |
| InChIKey | PXJMZAQJKURKMR-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(-c2ccc(O)c(O)c2)c(F)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[4-(3,4-dihydroxyphenyl)-3-fluorophenyl]propanoic acid |