2-chloro-4,7-diphenylcyclohepta-2,4,6-trien-1-one structure
|
Common Name | 2-chloro-4,7-diphenylcyclohepta-2,4,6-trien-1-one | ||
|---|---|---|---|---|
| CAS Number | 65961-18-4 | Molecular Weight | 292.75900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-4,7-diphenylcyclohepta-2,4,6-trien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H13ClO |
|---|---|
| Molecular Weight | 292.75900 |
| Exact Mass | 292.06500 |
| PSA | 17.07000 |
| LogP | 5.03420 |
| InChIKey | VFCWUGMXMOTUDR-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)cc(-c2ccccc2)ccc1-c1ccccc1 |
|
~%
2-chloro-4,7-di... CAS#:65961-18-4 |
| Literature: Huegel,H.M. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 2340 - 2342 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Chlor-4,7-diphenylcyclohepta-2,4,6-trienon |
| 2,4,6-Cycloheptatrien-1-one,2-chloro-4,7-diphenyl |