1-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine structure
|
Common Name | 1-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 6583-41-1 | Molecular Weight | 265.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11N3S |
|---|---|
| Molecular Weight | 265.33300 |
| Exact Mass | 265.06700 |
| PSA | 66.38000 |
| LogP | 3.95570 |
| InChIKey | YIHNHMFWRCCRPB-UHFFFAOYSA-N |
| SMILES | C(=Nc1nnc(-c2ccccc2)s1)c1ccccc1 |
|
~67%
1-phenyl-N-(5-p... CAS#:6583-41-1 |
| Literature: Padhy, Arun Kumar; Nag; Panda Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1999 , vol. 38, # 8 p. 998 - 1001 |
|
~%
1-phenyl-N-(5-p... CAS#:6583-41-1 |
| Literature: Pandey; Tusi; Tandon; Joshi; Bajpai Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 10 p. 2583 - 2588 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| benzylidene-(5-phenyl-[1,3,4]thiadiazol-2-yl)-amine |
| Benzyliden-(phenyl-[1,3,4]thiadiazol-2-yl)-amin |
| benzylidene-(phenyl-[1,3,4]thiadiazol-2-yl)-amine |
| 1,3,4-Thiadiazol-2-amine,5-phenyl-N-(phenylmethylene) |