1-(3-fluorophenyl)-2-pyridin-4-ylethanone structure
|
Common Name | 1-(3-fluorophenyl)-2-pyridin-4-ylethanone | ||
|---|---|---|---|---|
| CAS Number | 6576-04-1 | Molecular Weight | 215.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-fluorophenyl)-2-pyridin-4-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10FNO |
|---|---|
| Molecular Weight | 215.22300 |
| Exact Mass | 215.07500 |
| PSA | 29.96000 |
| LogP | 2.64610 |
| InChIKey | VUVBFCUAAOZARP-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccncc1)c1cccc(F)c1 |
|
~82%
1-(3-fluorophen... CAS#:6576-04-1 |
| Literature: ALMIRALL PRODESFARMA, S.A. Patent: WO2007/17096 A1, 2007 ; Location in patent: Page/Page column 55-56 ; WO 2007/017096 A1 |
|
~82%
1-(3-fluorophen... CAS#:6576-04-1 |
| Literature: Miwatashi, Seiji; Arikawa, Yasuyoshi; Naruo, Ken-Ichi; Igaki, Keiko; Watanabe, Yasumasa; Kimura, Hiroyuki; Kawamoto, Tomohiro; Ohkawa, Shigenori Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 4 p. 410 - 418 |
|
~%
1-(3-fluorophen... CAS#:6576-04-1 |
| Literature: Miwatashi, Seiji; Arikawa, Yasuyoshi; Naruo, Ken-Ichi; Igaki, Keiko; Watanabe, Yasumasa; Kimura, Hiroyuki; Kawamoto, Tomohiro; Ohkawa, Shigenori Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 4 p. 410 - 418 |
| 1-(3-fluorophenyl)-2-(pyridin-4-yl)ethan-1-one |
| 4-(3-Fluorphenacyl)-pyridin |
| 1-(3-fluorophenyl)-2-(pyridin-4-yl)ethanone |
| 1-(3-FLUOROPHENYL)-2-(4-PYRIDYL)ETHANONE |
| Ethanone,1-(3-fluorophenyl)-2-(4-pyridinyl) |