dimethyl benzene-1,3-dicarboxylate,2,2,4-trimethylpentane-1,3-diol
Modify Date: 2025-08-25 17:05:17
dimethyl benzene-1,3-dicarboxylate,2,2,4-trimethylpentane-1,3-diol structure
|
Common Name | dimethyl benzene-1,3-dicarboxylate,2,2,4-trimethylpentane-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 65072-12-0 | Molecular Weight | 340.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl benzene-1,3-dicarboxylate,2,2,4-trimethylpentane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H28O6 |
|---|---|
| Molecular Weight | 340.41100 |
| Exact Mass | 340.18900 |
| PSA | 93.06000 |
| LogP | 2.28160 |
| InChIKey | ARFFQIAZXGCLDR-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)C(C)(C)CO.COC(=O)c1cccc(C(=O)OC)c1 |
| 1,3-Benzenedicarboxylic acid,1,3-dimethyl ester,polymer with 2,2,4-trimethyl-1,3-pentanediol |
| 1,3-Benzenedicarboxylic acid,dimethyl ester,polymer with 2,2,4-trimethyl-1,3-pentanediol |
| Dimethyl isophthalate,2,2,4-trimethyl-1,3-pentanediol polymer |