S-[4-(4-bromophenyl)-4-oxobutyl] ethanethioate structure
|
Common Name | S-[4-(4-bromophenyl)-4-oxobutyl] ethanethioate | ||
|---|---|---|---|---|
| CAS Number | 649569-54-0 | Molecular Weight | 301.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-[4-(4-bromophenyl)-4-oxobutyl] ethanethioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13BrO2S |
|---|---|
| Molecular Weight | 301.19900 |
| Exact Mass | 299.98200 |
| PSA | 59.44000 |
| LogP | 3.69170 |
| InChIKey | UEVVOZGBICDANP-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCCC(=O)c1ccc(Br)cc1 |
|
~%
S-[4-(4-bromoph... CAS#:649569-54-0 |
| Literature: Noguchi, Toshiya; Hasegawa, Masahiro; Tomisawa, Kazuyuki; Mitsukuchi, Morihiro Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 22 p. 4729 - 4742 |
|
~%
S-[4-(4-bromoph... CAS#:649569-54-0 |
| Literature: Noguchi, Toshiya; Hasegawa, Masahiro; Tomisawa, Kazuyuki; Mitsukuchi, Morihiro Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 22 p. 4729 - 4742 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| Ethanethioic acid,S-[4-(4-bromophenyl)-4-oxobutyl] ester |