[1-cyano-3-(2-oxochromen-7-yl)oxypropyl] benzoate structure
|
Common Name | [1-cyano-3-(2-oxochromen-7-yl)oxypropyl] benzoate | ||
|---|---|---|---|---|
| CAS Number | 646507-39-3 | Molecular Weight | 349.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-cyano-3-(2-oxochromen-7-yl)oxypropyl] benzoate |
|---|
| Molecular Formula | C20H15NO5 |
|---|---|
| Molecular Weight | 349.33700 |
| Exact Mass | 349.09500 |
| PSA | 89.53000 |
| LogP | 3.31108 |
| InChIKey | YIPIQPUIOUIYDJ-UHFFFAOYSA-N |
| SMILES | N#CC(CCOc1ccc2ccc(=O)oc2c1)OC(=O)c1ccccc1 |
|
~89%
[1-cyano-3-(2-o... CAS#:646507-39-3 |
| Literature: Leroy, Emmanuel; Bensel, Nicolas; Reymond, Jean-Louis Advanced Synthesis and Catalysis, 2003 , vol. 345, # 6-7 p. 859 - 865 |
|
~%
[1-cyano-3-(2-o... CAS#:646507-39-3 |
| Literature: Leroy, Emmanuel; Bensel, Nicolas; Reymond, Jean-Louis Advanced Synthesis and Catalysis, 2003 , vol. 345, # 6-7 p. 859 - 865 |
|
~%
[1-cyano-3-(2-o... CAS#:646507-39-3 |
| Literature: Leroy, Emmanuel; Bensel, Nicolas; Reymond, Jean-Louis Advanced Synthesis and Catalysis, 2003 , vol. 345, # 6-7 p. 859 - 865 |