5-[tert-butyl(diphenyl)silyl]oxyoxan-2-ol structure
|
Common Name | 5-[tert-butyl(diphenyl)silyl]oxyoxan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 645412-77-7 | Molecular Weight | 356.53100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H28O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[tert-butyl(diphenyl)silyl]oxyoxan-2-ol |
|---|
| Molecular Formula | C21H28O3Si |
|---|---|
| Molecular Weight | 356.53100 |
| Exact Mass | 356.18100 |
| PSA | 38.69000 |
| LogP | 3.06040 |
| InChIKey | BABRXTQJOGVEBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](OC1CCC(O)OC1)(c1ccccc1)c1ccccc1 |
|
~96%
5-[tert-butyl(d... CAS#:645412-77-7 |
| Literature: Ayala, Leticia; Lucero, Claudia G.; Antoinette, Jan; Romero; Tabacco, Sarah A.; Woerpel Journal of the American Chemical Society, 2003 , vol. 125, # 50 p. 15521 - 15528 |
|
~%
5-[tert-butyl(d... CAS#:645412-77-7 |
| Literature: Ayala, Leticia; Lucero, Claudia G.; Antoinette, Jan; Romero; Tabacco, Sarah A.; Woerpel Journal of the American Chemical Society, 2003 , vol. 125, # 50 p. 15521 - 15528 |
|
~%
5-[tert-butyl(d... CAS#:645412-77-7 |
| Literature: Ayala, Leticia; Lucero, Claudia G.; Antoinette, Jan; Romero; Tabacco, Sarah A.; Woerpel Journal of the American Chemical Society, 2003 , vol. 125, # 50 p. 15521 - 15528 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |