6-(4-oxohexoxy)-3,4-dihydro-1H-quinolin-2-one structure
|
Common Name | 6-(4-oxohexoxy)-3,4-dihydro-1H-quinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 64463-16-7 | Molecular Weight | 261.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-oxohexoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|
| Molecular Formula | C15H19NO3 |
|---|---|
| Molecular Weight | 261.31600 |
| Exact Mass | 261.13600 |
| PSA | 55.40000 |
| LogP | 2.84740 |
| InChIKey | SMARTFVCWFSYQJ-UHFFFAOYSA-N |
| SMILES | CCC(=O)CCCOc1ccc2c(c1)CCC(=O)N2 |
|
~36%
6-(4-oxohexoxy)... CAS#:64463-16-7 |
| Literature: Nishi; Yamamoto; Shimizu; Kanbe; Kimura; Nakagawa Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 3 p. 798 - 810 |
|
~%
6-(4-oxohexoxy)... CAS#:64463-16-7 |
| Literature: Nishi; Yamamoto; Shimizu; Kanbe; Kimura; Nakagawa Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 3 p. 798 - 810 |
|
~%
6-(4-oxohexoxy)... CAS#:64463-16-7 |
| Literature: Nishi; Yamamoto; Shimizu; Kanbe; Kimura; Nakagawa Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 3 p. 798 - 810 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |