2-(diethylamino)-7-hydroxychromen-4-one structure
|
Common Name | 2-(diethylamino)-7-hydroxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 63961-71-7 | Molecular Weight | 233.26300 | |
| Density | 1.25g/cm3 | Boiling Point | 382.8ºC at 760 mmHg | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | 2-(diethylamino)-7-hydroxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 382.8ºC at 760 mmHg |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.26300 |
| Flash Point | 185.3ºC |
| Exact Mass | 233.10500 |
| PSA | 53.68000 |
| LogP | 2.34480 |
| Index of Refraction | 1.605 |
| InChIKey | AYZKEMDICVDVSU-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cc(=O)c2ccc(O)cc2o1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| rc 39ii |