2,3-dimethoxy-6-(4-methylpentyl)-1H-pyridin-4-one
Modify Date: 2025-08-25 14:24:12
2,3-dimethoxy-6-(4-methylpentyl)-1H-pyridin-4-one structure
|
Common Name | 2,3-dimethoxy-6-(4-methylpentyl)-1H-pyridin-4-one | ||
|---|---|---|---|---|
| CAS Number | 63642-90-0 | Molecular Weight | 239.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dimethoxy-6-(4-methylpentyl)-1H-pyridin-4-one |
|---|
| Molecular Formula | C13H21NO3 |
|---|---|
| Molecular Weight | 239.31100 |
| Exact Mass | 239.15200 |
| PSA | 51.58000 |
| LogP | 2.78310 |
| InChIKey | ZEMXDJRSOFTEJQ-UHFFFAOYSA-N |
| SMILES | COc1[nH]c(CCCC(C)C)cc(=O)c1OC |
|
~%
2,3-dimethoxy-6... CAS#:63642-90-0 |
| Literature: Yoshida; Nagao; Takahashi Agricultural and Biological Chemistry, 1980 , vol. 44, # 12 p. 2913 - 2920 |
|
~%
2,3-dimethoxy-6... CAS#:63642-90-0 |
| Literature: Yoshida; Nagao; Takahashi Agricultural and Biological Chemistry, 1980 , vol. 44, # 12 p. 2913 - 2920 |
|
~%
2,3-dimethoxy-6... CAS#:63642-90-0 |
| Literature: Yoshida; Nagao; Takahashi Agricultural and Biological Chemistry, 1980 , vol. 44, # 12 p. 2913 - 2920 |
