1,2,3,4-tetratert-butyl-1,2,3,4-tetramethyltetrasiletane structure
|
Common Name | 1,2,3,4-tetratert-butyl-1,2,3,4-tetramethyltetrasiletane | ||
|---|---|---|---|---|
| CAS Number | 63357-19-7 | Molecular Weight | 400.93700 | |
| Density | 0.83g/cm3 | Boiling Point | 351.1ºC at 760 mmHg | |
| Molecular Formula | C20H48Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.8ºC | |
| Name | 1,2,3,4-tetratert-butyl-1,2,3,4-tetramethyltetrasiletane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.83g/cm3 |
|---|---|
| Boiling Point | 351.1ºC at 760 mmHg |
| Molecular Formula | C20H48Si4 |
| Molecular Weight | 400.93700 |
| Flash Point | 130.8ºC |
| Exact Mass | 400.28300 |
| LogP | 7.82840 |
| Index of Refraction | 1.442 |
| InChIKey | UKLIXDKJSZEUSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si]1(C)[Si](C)(C(C)(C)C)[Si](C)(C(C)(C)C)[Si]1(C)C(C)(C)C |
|
~%
1,2,3,4-tetrate... CAS#:63357-19-7 |
| Literature: Block,T.F. et al. Journal of Organometallic Chemistry, 1977 , vol. 131, p. 199 - 205 |
|
~24%
1,2,3,4-tetrate... CAS#:63357-19-7 |
| Literature: Watanabe, Hamao; Inose, Jun; Fukushima, Koji; Kougo, Yuichi; Nagai, Yoichiro Chemistry Letters, 1983 , p. 1711 - 1714 |
| trans-1,2,3,4-tetra-tert-butyltetramethylcyclotetrasilane |
| Cyclotetrasilane,1,2,3,4-tetrakis(1-dimethylethyl)-1,2,3,4-tetramethyl |
| Tetra-(tert-butyl)-tetramethylcyclotetrasilan |