4-tert-butylphenol,formaldehyde,N-methylmethanamine structure
|
Common Name | 4-tert-butylphenol,formaldehyde,N-methylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 63150-12-9 | Molecular Weight | 225.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butylphenol,formaldehyde,N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H23NO2 |
|---|---|
| Molecular Weight | 225.32700 |
| Exact Mass | 225.17300 |
| PSA | 49.33000 |
| LogP | 3.36720 |
| InChIKey | DUFILDNMWZNILX-UHFFFAOYSA-N |
| SMILES | C=O.CC(C)(C)c1ccc(O)cc1.CNC |
| Formaldehyde,polymer with 4-(1,1-dimethylethyl)phenol and N-methylmethanamine |
| Dimethylamine,formaldehyde,p-tert-butyl phenol polymer |