4-chloro-N-(4-chlorophenyl)-N-methylbenzenesulfonamide structure
|
Common Name | 4-chloro-N-(4-chlorophenyl)-N-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 631-93-6 | Molecular Weight | 316.20300 | |
| Density | 1.43g/cm3 | Boiling Point | 444.7ºC at 760 mmHg | |
| Molecular Formula | C13H11Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7ºC | |
| Name | 4-chloro-N-(4-chlorophenyl)-N-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 444.7ºC at 760 mmHg |
| Molecular Formula | C13H11Cl2NO2S |
| Molecular Weight | 316.20300 |
| Flash Point | 222.7ºC |
| Exact Mass | 314.98900 |
| PSA | 45.76000 |
| LogP | 4.89930 |
| Index of Refraction | 1.628 |
| InChIKey | UXBUOQYOERKCRY-UHFFFAOYSA-N |
| SMILES | CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
|
~%
4-chloro-N-(4-c... CAS#:631-93-6 |
| Literature: Speroni Chimica e l'Industria (Milan, Italy), 1952 , vol. 34, p. 391,400 Full Text Show Details Neeman; Modiano Journal of Organic Chemistry, 1956 , vol. 21, p. 667,669 |
| 4-Chlor-benzolsulfonsaeure-(4-chlor-N-methyl-anilid) |
| 4,4'-Dichloro-N-methylbenzenesulfoanilide |
| S-150 |
| 4-chloro-benzenesulfonic acid-(4-chloro-N-methyl-anilide) |
| Benzenesulfonanilide,4,4'-dichloro-N-methyl |