1-methyl-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene structure
|
Common Name | 1-methyl-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene | ||
|---|---|---|---|---|
| CAS Number | 62897-49-8 | Molecular Weight | 346.46200 | |
| Density | 1.147g/cm3 | Boiling Point | 357ºC at 760 mmHg | |
| Molecular Formula | C24H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.9ºC | |
| Name | 1-methyl-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 357ºC at 760 mmHg |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.46200 |
| Flash Point | 150.9ºC |
| Exact Mass | 346.19300 |
| PSA | 18.46000 |
| LogP | 6.28170 |
| Index of Refraction | 1.564 |
| InChIKey | BKOIPYWPOJRHSU-UHFFFAOYSA-N |
| SMILES | CC(C)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~%
1-methyl-4-[2-m... CAS#:62897-49-8 |
| Literature: Skerrett; Woodcock Journal of the Chemical Society, 1950 , p. 2718,2721 |
|
~%
1-methyl-4-[2-m... CAS#:62897-49-8 |
| Literature: Skerrett; Woodcock Journal of the Chemical Society, 1950 , p. 2718,2721 |
|
~%
1-methyl-4-[2-m... CAS#:62897-49-8 |
| Literature: Skerrett; Woodcock Journal of the Chemical Society, 1950 , p. 2718,2721 |
|
~%
1-methyl-4-[2-m... CAS#:62897-49-8 |
| Literature: Skerrett; Woodcock Journal of the Chemical Society, 1950 , p. 2718,2721 |
| 1-((2-(4-Methylphenyl)-2-methylpropoxy)methyl)-3-phenoxybenzene |
| 1,1-bis-(4-chloro-phenyl)-2-methyl-propane |
| 1,1-Bis-(4-chlor-phenyl)-2-methyl-propan |
| Benzene,1-((2-(4-methylphenyl)-2-methylpropoxy)methyl)-3-phenoxy |
| 3-Phenoxybenzyl 2-(4-methylphenyl)-2-methylpropyl ether |