2-propan-2-yltetracene-5,12-dione
Modify Date: 2024-12-04 19:59:34
2-propan-2-yltetracene-5,12-dione structure
|
Common Name | 2-propan-2-yltetracene-5,12-dione | ||
|---|---|---|---|---|
| CAS Number | 62775-15-9 | Molecular Weight | 300.35100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-propan-2-yltetracene-5,12-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H16O2 |
|---|---|
| Molecular Weight | 300.35100 |
| Exact Mass | 300.11500 |
| PSA | 34.14000 |
| LogP | 4.73860 |
| InChIKey | XHVZKEJWYBZDLY-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc2c(c1)C(=O)c1cc3ccccc3cc1C2=O |
|
~%
2-propan-2-ylte... CAS#:62775-15-9 |
| Literature: Cook Journal of the Chemical Society, 1934 , p. 1412 |
| 2-isopropyl-naphthacene-5,12-dione |
| 2-Isopropyl-naphthacen-5,12-dion |
| 5,12-Naphthacenedione,2-(1-methylethyl) |